C17H28 — CID 166501283
2,14-dimethylpentadeca-4,6-diyne (PubChem CID 166501283) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is 2,14-dimethylpentadeca-4,6-diyne.
| Compound Name | 2,14-dimethylpentadeca-4,6-diyne |
|---|---|
| PubChem CID | 166501283 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 2,14-dimethylpentadeca-4,6-diyne |
| SMILES | CC(C)CC#CC#CCCCCCCC(C)C |
| InChI | InChI=1S/C17H28/c1-16(2)14-12-10-8-6-5-7-9-11-13-15-17(3)4/h16-17H,5-6,8,10,12,14-15H2,1-4H3 |
| InChIKey | PUDHKHURPWHETI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|