About 19-methylicos-11-yn-1-ol
19-methylicos-11-yn-1-ol (PubChem CID 141402003) has the molecular formula C21H40O
and a molecular weight of 308.55 g/mol. Its IUPAC name is 19-methylicos-11-yn-1-ol.
Molecular Properties
| Compound Name | 19-methylicos-11-yn-1-ol |
| PubChem CID | 141402003 |
| Molecular Formula | C21H40O |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.31 |
| IUPAC Name | 19-methylicos-11-yn-1-ol |
| SMILES | CC(C)CCCCCCC#CCCCCCCCCCCO |
| InChI | InChI=1S/C21H40O/c1-21(2)19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22/h21-22H,3-4,6,8-20H2,1-2H3 |
| InChIKey | HGBFRMYRZJCKTB-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 19-methylicos-11-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 19-methylicos-11-yn-1-ol?
The IUPAC name of 19-methylicos-11-yn-1-ol (CID 141402003) is 19-methylicos-11-yn-1-ol.
What is the SMILES notation for 19-methylicos-11-yn-1-ol?
The canonical SMILES for 19-methylicos-11-yn-1-ol is CC(C)CCCCCCC#CCCCCCCCCCCO.
What is the InChIKey of 19-methylicos-11-yn-1-ol?
The InChIKey is HGBFRMYRZJCKTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O/c1-21(2)19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22/h21-22H,3-4,6,8-20H2,1-2H3.
What are the key properties of 19-methylicos-11-yn-1-ol?
19-methylicos-11-yn-1-ol has a molecular weight of 308.55 g/mol, XLogP of 6.49, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 19-methylicos-11-yn-1-ol is sourced from PubChem (CID 141402003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).