C33H38N4O5 — CID 166504027
benzyl 3,3-dimethyl-5-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-4-(4-phenylbutylcarbamoyl)piperazine-1-carboxylate (PubChem CID 166504027) has the molecular formula C33H38N4O5 and a molecular weight of 570.69 g/mol. Its IUPAC name is benzyl 3,3-dimethyl-5-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-4-(4-phenylbutylcarbamoyl)piperazine-1-carboxylate.
| Compound Name | benzyl 3,3-dimethyl-5-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-4-(4-phenylbutylcarbamoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166504027 |
| Molecular Formula | C33H38N4O5 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | benzyl 3,3-dimethyl-5-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-4-(4-phenylbutylcarbamoyl)piperazine-1-carboxylate |
| SMILES | Cn1c(=O)oc2cc(C3CN(C(=O)OCc4ccccc4)CC(C)(C)N3C(=O)NCCCCc3ccccc3)ccc21 |
| InChI | InChI=1S/C33H38N4O5/c1-33(2)23-36(32(40)41-22-25-15-8-5-9-16-25)21-28(26-17-18-27-29(20-26)42-31(39)35(27)3)37(33)30(38)34-19-11-10-14-24-12-6-4-7-13-24/h4-9,12-13,15-18,20,28H,10-11,14,19,21-23H2,1-3H3,(H,34,38) |
| InChIKey | WNYWHEDEOUJWFP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|