C27H38BN3O6 — CID 166504411
tert-butyl N-(2-hydroxyethyl)-N-[[6-[[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]-3-pyridinyl]methyl]carbamate (PubChem CID 166504411) has the molecular formula C27H38BN3O6 and a molecular weight of 511.43 g/mol. Its IUPAC name is tert-butyl N-(2-hydroxyethyl)-N-[[6-[[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]-3-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-(2-hydroxyethyl)-N-[[6-[[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]-3-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 166504411 |
| Molecular Formula | C27H38BN3O6 |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | tert-butyl N-(2-hydroxyethyl)-N-[[6-[[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]-3-pyridinyl]methyl]carbamate |
| SMILES | Cc1c(NC(=O)c2ccc(CN(CCO)C(=O)OC(C)(C)C)cn2)cccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C27H38BN3O6/c1-18-20(28-36-26(5,6)27(7,8)37-28)10-9-11-21(18)30-23(33)22-13-12-19(16-29-22)17-31(14-15-32)24(34)35-25(2,3)4/h9-13,16,32H,14-15,17H2,1-8H3,(H,30,33) |
| InChIKey | NNZSEQWPPQJXBQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|