C13H23N3O4 — CID 166506359
N,2,2-trimethyl-N'-[2-(3-oxomorpholin-4-yl)ethyl]butanediamide (PubChem CID 166506359) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is N,2,2-trimethyl-N'-[2-(3-oxomorpholin-4-yl)ethyl]butanediamide.
| Compound Name | N,2,2-trimethyl-N'-[2-(3-oxomorpholin-4-yl)ethyl]butanediamide |
|---|---|
| PubChem CID | 166506359 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N,2,2-trimethyl-N'-[2-(3-oxomorpholin-4-yl)ethyl]butanediamide |
| SMILES | CNC(=O)C(C)(C)CC(=O)NCCN1CCOCC1=O |
| InChI | InChI=1S/C13H23N3O4/c1-13(2,12(19)14-3)8-10(17)15-4-5-16-6-7-20-9-11(16)18/h4-9H2,1-3H3,(H,14,19)(H,15,17) |
| InChIKey | YPZYYKNSFHBUSS-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |