C15H17N5O2S — CID 166509596
4-[4-[2-(sulfamoylamino)propan-2-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 166509596) has the molecular formula C15H17N5O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is 4-[4-[2-(sulfamoylamino)propan-2-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-[4-[2-(sulfamoylamino)propan-2-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 166509596 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 4-[4-[2-(sulfamoylamino)propan-2-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | CC(C)(NS(N)(=O)=O)c1ccc(-c2ncnc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C15H17N5O2S/c1-15(2,20-23(16,21)22)11-5-3-10(4-6-11)13-12-7-8-17-14(12)19-9-18-13/h3-9,20H,1-2H3,(H2,16,21,22)(H,17,18,19) |
| InChIKey | AJLOVEORFYGVOQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |