About tert-butyl N-[2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]propan-2-ylsulfamoyl]carbamate
tert-butyl N-[2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]propan-2-ylsulfamoyl]carbamate (PubChem CID 166509545) has the molecular formula C20H25N5O4S
and a molecular weight of 431.52 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]propan-2-ylsulfamoyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]propan-2-ylsulfamoyl]carbamate |
| PubChem CID | 166509545 |
| Molecular Formula | C20H25N5O4S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | tert-butyl N-[2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]propan-2-ylsulfamoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)NC(C)(C)c1ccc(-c2ncnc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C20H25N5O4S/c1-19(2,3)29-18(26)24-30(27,28)25-20(4,5)14-8-6-13(7-9-14)16-15-10-11-21-17(15)23-12-22-16/h6-12,25H,1-5H3,(H,24,26)(H,21,22,23) |
| InChIKey | UWBJKWNMVHLIDD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]propan-2-ylsulfamoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]propan-2-ylsulfamoyl]carbamate?
The IUPAC name of tert-butyl N-[2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]propan-2-ylsulfamoyl]carbamate (CID 166509545) is tert-butyl N-[2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]propan-2-ylsulfamoyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]propan-2-ylsulfamoyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]propan-2-ylsulfamoyl]carbamate is CC(C)(C)OC(=O)NS(=O)(=O)NC(C)(C)c1ccc(-c2ncnc3[nH]ccc23)cc1.
What is the InChIKey of tert-butyl N-[2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]propan-2-ylsulfamoyl]carbamate?
The InChIKey is UWBJKWNMVHLIDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N5O4S/c1-19(2,3)29-18(26)24-30(27,28)25-20(4,5)14-8-6-13(7-9-14)16-15-10-11-21-17(15)23-12-22-16/h6-12,25H,1-5H3,(H,24,26)(H,21,22,23).
What are the key properties of tert-butyl N-[2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]propan-2-ylsulfamoyl]carbamate?
tert-butyl N-[2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]propan-2-ylsulfamoyl]carbamate has a molecular weight of 431.52 g/mol, XLogP of 3.22, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]propan-2-ylsulfamoyl]carbamate is sourced from PubChem (CID 166509545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).