C25H31N5O2 — CID 123555753
tert-butyl N-[N'-[[4-(4-tert-butylphenyl)quinazolin-8-yl]methyl]carbamimidoyl]carbamate (PubChem CID 123555753) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is tert-butyl N-[N'-[[4-(4-tert-butylphenyl)quinazolin-8-yl]methyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[[4-(4-tert-butylphenyl)quinazolin-8-yl]methyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 123555753 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | tert-butyl N-[N'-[[4-(4-tert-butylphenyl)quinazolin-8-yl]methyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N/C(N)=N/Cc1cccc2c(-c3ccc(C(C)(C)C)cc3)ncnc12 |
| InChI | InChI=1S/C25H31N5O2/c1-24(2,3)18-12-10-16(11-13-18)20-19-9-7-8-17(21(19)29-15-28-20)14-27-22(26)30-23(31)32-25(4,5)6/h7-13,15H,14H2,1-6H3,(H3,26,27,30,31) |
| InChIKey | QTRSKVSPYKPJHV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|