C13H18BrN3O2 — CID 143717985
tert-butyl N-[N'-[(3-bromophenyl)methyl]carbamimidoyl]carbamate (PubChem CID 143717985) has the molecular formula C13H18BrN3O2 and a molecular weight of 328.21 g/mol. Its IUPAC name is tert-butyl N-[N'-[(3-bromophenyl)methyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[(3-bromophenyl)methyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 143717985 |
| Molecular Formula | C13H18BrN3O2 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | tert-butyl N-[N'-[(3-bromophenyl)methyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N/C(N)=N/Cc1cccc(Br)c1 |
| InChI | InChI=1S/C13H18BrN3O2/c1-13(2,3)19-12(18)17-11(15)16-8-9-5-4-6-10(14)7-9/h4-7H,8H2,1-3H3,(H3,15,16,17,18) |
| InChIKey | LXZASXDNOOGPEA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|