C18H28N3O5P — CID 142031169
[3-[[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]methyl]phenyl]phosphinous acid (PubChem CID 142031169) has the molecular formula C18H28N3O5P and a molecular weight of 397.41 g/mol. Its IUPAC name is [3-[[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]methyl]phenyl]phosphinous acid.
| Compound Name | [3-[[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]methyl]phenyl]phosphinous acid |
|---|---|
| PubChem CID | 142031169 |
| Molecular Formula | C18H28N3O5P |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | [3-[[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]methyl]phenyl]phosphinous acid |
| SMILES | CC(C)(C)OC(=O)NC(=NCc1cccc(PO)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N3O5P/c1-17(2,3)25-15(22)20-14(21-16(23)26-18(4,5)6)19-11-12-8-7-9-13(10-12)27-24/h7-10,24,27H,11H2,1-6H3,(H2,19,20,21,22,23) |
| InChIKey | SUZRNKRLWHTWOY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|