C21H31N3O5 — CID 176564767
3-[[[[(1-hydroxy-2-methylhex-5-en-2-yl)amino]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]methyl]benzoic acid (PubChem CID 176564767) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-[[[[(1-hydroxy-2-methylhex-5-en-2-yl)amino]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]methyl]benzoic acid.
| Compound Name | 3-[[[[(1-hydroxy-2-methylhex-5-en-2-yl)amino]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 176564767 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 3-[[[[(1-hydroxy-2-methylhex-5-en-2-yl)amino]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]methyl]benzoic acid |
| SMILES | C=CCCC(C)(CO)N/C(=N/Cc1cccc(C(=O)O)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31N3O5/c1-6-7-11-21(5,14-25)24-18(23-19(28)29-20(2,3)4)22-13-15-9-8-10-16(12-15)17(26)27/h6,8-10,12,25H,1,7,11,13-14H2,2-5H3,(H,26,27)(H2,22,23,24,28) |
| InChIKey | DSPLJDGKTAZPMQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|