C25H39N5O7 — CID 67453314
tert-butyl N-[2-[3-[[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]methyl]anilino]-2-oxoethyl]carbamate (PubChem CID 67453314) has the molecular formula C25H39N5O7 and a molecular weight of 521.62 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]methyl]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]methyl]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 67453314 |
| Molecular Formula | C25H39N5O7 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | tert-butyl N-[2-[3-[[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]methyl]anilino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Nc1cccc(CN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C25H39N5O7/c1-23(2,3)35-20(32)27-15-18(31)28-17-12-10-11-16(13-17)14-26-19(29-21(33)36-24(4,5)6)30-22(34)37-25(7,8)9/h10-13H,14-15H2,1-9H3,(H,27,32)(H,28,31)(H2,26,29,30,33,34) |
| InChIKey | BBKSNXVGKXFZIT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 156.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|