C15H24N4O2 — CID 140982009
tert-butyl N-[N-[3-(aminomethyl)phenyl]-N'-ethylcarbamimidoyl]carbamate (PubChem CID 140982009) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is tert-butyl N-[N-[3-(aminomethyl)phenyl]-N'-ethylcarbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-[3-(aminomethyl)phenyl]-N'-ethylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 140982009 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | tert-butyl N-[N-[3-(aminomethyl)phenyl]-N'-ethylcarbamimidoyl]carbamate |
| SMILES | CC/N=C(\NC(=O)OC(C)(C)C)Nc1cccc(CN)c1 |
| InChI | InChI=1S/C15H24N4O2/c1-5-17-13(19-14(20)21-15(2,3)4)18-12-8-6-7-11(9-12)10-16/h6-9H,5,10,16H2,1-4H3,(H2,17,18,19,20) |
| InChIKey | MCZMCROXTLCFNV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|