C22H36N4O4 — CID 22981354
tert-butyl N-[N'-ethyl-N-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]phenyl]carbamimidoyl]carbamate (PubChem CID 22981354) has the molecular formula C22H36N4O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is tert-butyl N-[N'-ethyl-N-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]phenyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-ethyl-N-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]phenyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 22981354 |
| Molecular Formula | C22H36N4O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | tert-butyl N-[N'-ethyl-N-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]phenyl]carbamimidoyl]carbamate |
| SMILES | CC/N=C(\NC(=O)OC(C)(C)C)Nc1cccc(C(C)(C)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H36N4O4/c1-10-23-17(25-18(27)29-20(2,3)4)24-16-13-11-12-15(14-16)22(8,9)26-19(28)30-21(5,6)7/h11-14H,10H2,1-9H3,(H,26,28)(H2,23,24,25,27) |
| InChIKey | DBGVKMAUQCQLHI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|