C18H28N4O4 — CID 18622060
2-[4-[[N'-ethyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]-3-methylphenyl]ethylcarbamic acid (PubChem CID 18622060) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-[4-[[N'-ethyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]-3-methylphenyl]ethylcarbamic acid.
| Compound Name | 2-[4-[[N'-ethyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]-3-methylphenyl]ethylcarbamic acid |
|---|---|
| PubChem CID | 18622060 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 2-[4-[[N'-ethyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]-3-methylphenyl]ethylcarbamic acid |
| SMILES | CC/N=C(\NC(=O)OC(C)(C)C)Nc1ccc(CCNC(=O)O)cc1C |
| InChI | InChI=1S/C18H28N4O4/c1-6-19-15(22-17(25)26-18(3,4)5)21-14-8-7-13(11-12(14)2)9-10-20-16(23)24/h7-8,11,20H,6,9-10H2,1-5H3,(H,23,24)(H2,19,21,22,25) |
| InChIKey | WWVHLRZKLUFZJN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|