C21H32N4O6 — CID 154172525
methyl 5-[[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]methyl]-2-(methylamino)benzoate (PubChem CID 154172525) has the molecular formula C21H32N4O6 and a molecular weight of 436.51 g/mol. Its IUPAC name is methyl 5-[[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]methyl]-2-(methylamino)benzoate.
| Compound Name | methyl 5-[[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]methyl]-2-(methylamino)benzoate |
|---|---|
| PubChem CID | 154172525 |
| Molecular Formula | C21H32N4O6 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | methyl 5-[[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]methyl]-2-(methylamino)benzoate |
| SMILES | CNc1ccc(CN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc1C(=O)OC |
| InChI | InChI=1S/C21H32N4O6/c1-20(2,3)30-18(27)24-17(25-19(28)31-21(4,5)6)23-12-13-9-10-15(22-7)14(11-13)16(26)29-8/h9-11,22H,12H2,1-8H3,(H2,23,24,25,27,28) |
| InChIKey | ITTVMKULXBQABD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|