C18H25F2N3O5 — CID 121464118
tert-butyl N-[N'-[(2,6-difluoro-3-hydroxyphenyl)methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 121464118) has the molecular formula C18H25F2N3O5 and a molecular weight of 401.41 g/mol. Its IUPAC name is tert-butyl N-[N'-[(2,6-difluoro-3-hydroxyphenyl)methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[(2,6-difluoro-3-hydroxyphenyl)methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 121464118 |
| Molecular Formula | C18H25F2N3O5 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | tert-butyl N-[N'-[(2,6-difluoro-3-hydroxyphenyl)methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCc1c(F)ccc(O)c1F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25F2N3O5/c1-17(2,3)27-15(25)22-14(23-16(26)28-18(4,5)6)21-9-10-11(19)7-8-12(24)13(10)20/h7-8,24H,9H2,1-6H3,(H2,21,22,23,25,26) |
| InChIKey | MLKRZEJVTSESQS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|