C17H22N4O5 — CID 146509200
tert-butyl N-[N-(5-cyano-2-hydroxybenzoyl)-N'-(3-hydroxypropyl)carbamimidoyl]carbamate (PubChem CID 146509200) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is tert-butyl N-[N-(5-cyano-2-hydroxybenzoyl)-N'-(3-hydroxypropyl)carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-(5-cyano-2-hydroxybenzoyl)-N'-(3-hydroxypropyl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 146509200 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | tert-butyl N-[N-(5-cyano-2-hydroxybenzoyl)-N'-(3-hydroxypropyl)carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N/C(=N\CCCO)NC(=O)c1cc(C#N)ccc1O |
| InChI | InChI=1S/C17H22N4O5/c1-17(2,3)26-16(25)21-15(19-7-4-8-22)20-14(24)12-9-11(10-18)5-6-13(12)23/h5-6,9,22-23H,4,7-8H2,1-3H3,(H2,19,20,21,24,25) |
| InChIKey | HTLPNMABRLPWQE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 144.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|