C17H26N4O4 — CID 18621841
2-[3-[[N'-ethyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]phenyl]ethylcarbamic acid (PubChem CID 18621841) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-[3-[[N'-ethyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]phenyl]ethylcarbamic acid.
| Compound Name | 2-[3-[[N'-ethyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]phenyl]ethylcarbamic acid |
|---|---|
| PubChem CID | 18621841 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-[3-[[N'-ethyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]phenyl]ethylcarbamic acid |
| SMILES | CC/N=C(\NC(=O)OC(C)(C)C)Nc1cccc(CCNC(=O)O)c1 |
| InChI | InChI=1S/C17H26N4O4/c1-5-18-14(21-16(24)25-17(2,3)4)20-13-8-6-7-12(11-13)9-10-19-15(22)23/h6-8,11,19H,5,9-10H2,1-4H3,(H,22,23)(H2,18,20,21,24) |
| InChIKey | OZYSTFDPUDCTTI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|