C40H37NO5P+ — CID 166510505
4-[4-[7-(ethylcarbamoyloxy)-8-hydroxy-4-oxochromen-2-yl]phenyl]butyl-triphenylphosphanium (PubChem CID 166510505) has the molecular formula C40H37NO5P+ and a molecular weight of 642.71 g/mol. Its IUPAC name is 4-[4-[7-(ethylcarbamoyloxy)-8-hydroxy-4-oxochromen-2-yl]phenyl]butyl-triphenylphosphanium.
| Compound Name | 4-[4-[7-(ethylcarbamoyloxy)-8-hydroxy-4-oxochromen-2-yl]phenyl]butyl-triphenylphosphanium |
|---|---|
| PubChem CID | 166510505 |
| Molecular Formula | C40H37NO5P+ |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | 4-[4-[7-(ethylcarbamoyloxy)-8-hydroxy-4-oxochromen-2-yl]phenyl]butyl-triphenylphosphanium |
| SMILES | CCNC(=O)Oc1ccc2c(=O)cc(-c3ccc(CCCC[P+](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)oc2c1O |
| InChI | InChI=1S/C40H36NO5P/c1-2-41-40(44)46-36-26-25-34-35(42)28-37(45-39(34)38(36)43)30-23-21-29(22-24-30)14-12-13-27-47(31-15-6-3-7-16-31,32-17-8-4-9-18-32)33-19-10-5-11-20-33/h3-11,15-26,28H,2,12-14,27H2,1H3,(H-,41,43,44)/p+1 |
| InChIKey | QNFYMBYDHWICPR-UHFFFAOYSA-O |
| XLogP | 7.59 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|