C26H23N5O3 — CID 166513043
(E)-2-cyano-N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-3-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide (PubChem CID 166513043) has the molecular formula C26H23N5O3 and a molecular weight of 453.50 g/mol. Its IUPAC name is (E)-2-cyano-N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-3-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-3-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 166513043 |
| Molecular Formula | C26H23N5O3 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | (E)-2-cyano-N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-3-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide |
| SMILES | COc1ccc([C@@H](C)NC(=O)/C(C#N)=C/c2c[nH]c3ncc(-c4cccnc4)cc23)cc1OC |
| InChI | InChI=1S/C26H23N5O3/c1-16(17-6-7-23(33-2)24(11-17)34-3)31-26(32)19(12-27)9-21-15-30-25-22(21)10-20(14-29-25)18-5-4-8-28-13-18/h4-11,13-16H,1-3H3,(H,29,30)(H,31,32)/b19-9+/t16-/m1/s1 |
| InChIKey | WIYZPNUQWRFJJX-LEKRSAHOSA-N |
| XLogP | 4.43 |
| TPSA | 112.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|