C25H24N6O3S — CID 167239471
(E)-2-cyano-N-[1-(3-methoxy-4-methylsulfinylphenyl)ethyl]-3-[5-(1-methylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide (PubChem CID 167239471) has the molecular formula C25H24N6O3S and a molecular weight of 488.57 g/mol. Its IUPAC name is (E)-2-cyano-N-[1-(3-methoxy-4-methylsulfinylphenyl)ethyl]-3-[5-(1-methylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[1-(3-methoxy-4-methylsulfinylphenyl)ethyl]-3-[5-(1-methylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 167239471 |
| Molecular Formula | C25H24N6O3S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | (E)-2-cyano-N-[1-(3-methoxy-4-methylsulfinylphenyl)ethyl]-3-[5-(1-methylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
| SMILES | COc1cc(C(C)NC(=O)/C(C#N)=C/c2c[nH]c3ncc(-c4cnn(C)c4)cc23)ccc1S(C)=O |
| InChI | InChI=1S/C25H24N6O3S/c1-15(16-5-6-23(35(4)33)22(9-16)34-3)30-25(32)17(10-26)7-19-12-28-24-21(19)8-18(11-27-24)20-13-29-31(2)14-20/h5-9,11-15H,1-4H3,(H,27,28)(H,30,32)/b17-7+ |
| InChIKey | AVUVCEDRBVPKHO-REZTVBANSA-N |
| XLogP | 3.49 |
| TPSA | 125.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|