C28H24N6O3 — CID 166529075
(E)-2-cyano-N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-3-(5-pyrazolo[1,5-a]pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide (PubChem CID 166529075) has the molecular formula C28H24N6O3 and a molecular weight of 492.54 g/mol. Its IUPAC name is (E)-2-cyano-N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-3-(5-pyrazolo[1,5-a]pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-3-(5-pyrazolo[1,5-a]pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 166529075 |
| Molecular Formula | C28H24N6O3 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | (E)-2-cyano-N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-3-(5-pyrazolo[1,5-a]pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide |
| SMILES | COc1ccc([C@@H](C)NC(=O)/C(C#N)=C/c2c[nH]c3ncc(-c4cnn5ccccc45)cc23)cc1OC |
| InChI | InChI=1S/C28H24N6O3/c1-17(18-7-8-25(36-2)26(12-18)37-3)33-28(35)19(13-29)10-20-14-30-27-22(20)11-21(15-31-27)23-16-32-34-9-5-4-6-24(23)34/h4-12,14-17H,1-3H3,(H,30,31)(H,33,35)/b19-10+/t17-/m1/s1 |
| InChIKey | OTEFQLUKASPQPX-OXNWSPOFSA-N |
| XLogP | 4.68 |
| TPSA | 117.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|