C13H19N3O4S — CID 166513391
methyl 2-[(5-formyl-2-methylsulfanylpyrimidin-4-yl)-[(2S)-1-methoxypropan-2-yl]amino]acetate (PubChem CID 166513391) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is methyl 2-[(5-formyl-2-methylsulfanylpyrimidin-4-yl)-[(2S)-1-methoxypropan-2-yl]amino]acetate.
| Compound Name | methyl 2-[(5-formyl-2-methylsulfanylpyrimidin-4-yl)-[(2S)-1-methoxypropan-2-yl]amino]acetate |
|---|---|
| PubChem CID | 166513391 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | methyl 2-[(5-formyl-2-methylsulfanylpyrimidin-4-yl)-[(2S)-1-methoxypropan-2-yl]amino]acetate |
| SMILES | COC[C@H](C)N(CC(=O)OC)c1nc(SC)ncc1C=O |
| InChI | InChI=1S/C13H19N3O4S/c1-9(8-19-2)16(6-11(18)20-3)12-10(7-17)5-14-13(15-12)21-4/h5,7,9H,6,8H2,1-4H3/t9-/m0/s1 |
| InChIKey | GLRXDGPZTSHJPY-VIFPVBQESA-N |
| XLogP | 1.03 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|