C10H14F3NO2 — CID 166513698
(4-hydroxypiperidin-1-yl)-[1-(trifluoromethyl)cyclopropyl]methanone (PubChem CID 166513698) has the molecular formula C10H14F3NO2 and a molecular weight of 237.22 g/mol. Its IUPAC name is (4-hydroxypiperidin-1-yl)-[1-(trifluoromethyl)cyclopropyl]methanone.
| Compound Name | (4-hydroxypiperidin-1-yl)-[1-(trifluoromethyl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 166513698 |
| Molecular Formula | C10H14F3NO2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (4-hydroxypiperidin-1-yl)-[1-(trifluoromethyl)cyclopropyl]methanone |
| SMILES | O=C(N1CCC(O)CC1)C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H14F3NO2/c11-10(12,13)9(3-4-9)8(16)14-5-1-7(15)2-6-14/h7,15H,1-6H2 |
| InChIKey | MTTDKKBNDAMNMY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |