C11H18ClF3N2O — CID 166513702
[4-(aminomethyl)piperidin-1-yl]-[1-(trifluoromethyl)cyclopropyl]methanone;hydrochloride (PubChem CID 166513702) has the molecular formula C11H18ClF3N2O and a molecular weight of 286.73 g/mol. Its IUPAC name is [4-(aminomethyl)piperidin-1-yl]-[1-(trifluoromethyl)cyclopropyl]methanone;hydrochloride.
| Compound Name | [4-(aminomethyl)piperidin-1-yl]-[1-(trifluoromethyl)cyclopropyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 166513702 |
| Molecular Formula | C11H18ClF3N2O |
| Molecular Weight | 286.73 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | [4-(aminomethyl)piperidin-1-yl]-[1-(trifluoromethyl)cyclopropyl]methanone;hydrochloride |
| SMILES | Cl.NCC1CCN(C(=O)C2(C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C11H17F3N2O.ClH/c12-11(13,14)10(3-4-10)9(17)16-5-1-8(7-15)2-6-16;/h8H,1-7,15H2;1H |
| InChIKey | WJAYAVZWCLNRJR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.73 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |