C16H21F2N3O5S — CID 166516984
ethyl 3-[2-(2,2-difluorocyclopropyl)oxyethyl-(ethoxycarbonylcarbamothioyl)amino]-1H-pyrrole-2-carboxylate (PubChem CID 166516984) has the molecular formula C16H21F2N3O5S and a molecular weight of 405.42 g/mol. Its IUPAC name is ethyl 3-[2-(2,2-difluorocyclopropyl)oxyethyl-(ethoxycarbonylcarbamothioyl)amino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[2-(2,2-difluorocyclopropyl)oxyethyl-(ethoxycarbonylcarbamothioyl)amino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 166516984 |
| Molecular Formula | C16H21F2N3O5S |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | ethyl 3-[2-(2,2-difluorocyclopropyl)oxyethyl-(ethoxycarbonylcarbamothioyl)amino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)NC(=S)N(CCOC1CC1(F)F)c1cc[nH]c1C(=O)OCC |
| InChI | InChI=1S/C16H21F2N3O5S/c1-3-24-13(22)12-10(5-6-19-12)21(14(27)20-15(23)25-4-2)7-8-26-11-9-16(11,17)18/h5-6,11,19H,3-4,7-9H2,1-2H3,(H,20,23,27) |
| InChIKey | GGPSEVPARJIWEL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|