C15H15F3N2O3 — CID 166517069
ethyl 3-[[3-(difluoromethoxy)-4-fluorophenyl]methylamino]-1H-pyrrole-2-carboxylate (PubChem CID 166517069) has the molecular formula C15H15F3N2O3 and a molecular weight of 328.29 g/mol. Its IUPAC name is ethyl 3-[[3-(difluoromethoxy)-4-fluorophenyl]methylamino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[[3-(difluoromethoxy)-4-fluorophenyl]methylamino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 166517069 |
| Molecular Formula | C15H15F3N2O3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | ethyl 3-[[3-(difluoromethoxy)-4-fluorophenyl]methylamino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]ccc1NCc1ccc(F)c(OC(F)F)c1 |
| InChI | InChI=1S/C15H15F3N2O3/c1-2-22-14(21)13-11(5-6-19-13)20-8-9-3-4-10(16)12(7-9)23-15(17)18/h3-7,15,19-20H,2,8H2,1H3 |
| InChIKey | KKLLOBDNAWTAAO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |