C20H28F3N3O5S — CID 166517083
ethyl 3-[ethoxycarbonylcarbamothioyl-[2-[1-(trifluoromethyl)cyclohexyl]oxyethyl]amino]-1H-pyrrole-2-carboxylate (PubChem CID 166517083) has the molecular formula C20H28F3N3O5S and a molecular weight of 479.52 g/mol. Its IUPAC name is ethyl 3-[ethoxycarbonylcarbamothioyl-[2-[1-(trifluoromethyl)cyclohexyl]oxyethyl]amino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[ethoxycarbonylcarbamothioyl-[2-[1-(trifluoromethyl)cyclohexyl]oxyethyl]amino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 166517083 |
| Molecular Formula | C20H28F3N3O5S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | ethyl 3-[ethoxycarbonylcarbamothioyl-[2-[1-(trifluoromethyl)cyclohexyl]oxyethyl]amino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)NC(=S)N(CCOC1(C(F)(F)F)CCCCC1)c1cc[nH]c1C(=O)OCC |
| InChI | InChI=1S/C20H28F3N3O5S/c1-3-29-16(27)15-14(8-11-24-15)26(17(32)25-18(28)30-4-2)12-13-31-19(20(21,22)23)9-6-5-7-10-19/h8,11,24H,3-7,9-10,12-13H2,1-2H3,(H,25,28,32) |
| InChIKey | GKETVNOWNZUQLR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|