C18H22N3O2P — CID 166517174
4-diphenylphosphanylbenzene-1,2,3-triamine;dihydrate (PubChem CID 166517174) has the molecular formula C18H22N3O2P and a molecular weight of 343.37 g/mol. Its IUPAC name is 4-diphenylphosphanylbenzene-1,2,3-triamine;dihydrate.
| Compound Name | 4-diphenylphosphanylbenzene-1,2,3-triamine;dihydrate |
|---|---|
| PubChem CID | 166517174 |
| Molecular Formula | C18H22N3O2P |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4-diphenylphosphanylbenzene-1,2,3-triamine;dihydrate |
| SMILES | Nc1ccc(P(c2ccccc2)c2ccccc2)c(N)c1N.O.O |
| InChI | InChI=1S/C18H18N3P.2H2O/c19-15-11-12-16(18(21)17(15)20)22(13-7-3-1-4-8-13)14-9-5-2-6-10-14;;/h1-12H,19-21H2;2*1H2 |
| InChIKey | YKBZQAFGFXYUDK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|