About disodium;dioxido(phenyl)phosphane
disodium;dioxido(phenyl)phosphane (PubChem CID 22598239) has the molecular formula C6H5Na2O2P
and a molecular weight of 186.06 g/mol. Its IUPAC name is disodium;dioxido(phenyl)phosphane.
Molecular Properties
| Compound Name | disodium;dioxido(phenyl)phosphane |
| PubChem CID | 22598239 |
| Molecular Formula | C6H5Na2O2P |
| Molecular Weight | 186.06 g/mol |
| Exact Mass | 185.98 |
| IUPAC Name | disodium;dioxido(phenyl)phosphane |
| SMILES | [Na+].[Na+].[O-]P([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5O2P.2Na/c7-9(8)6-4-2-1-3-5-6;;/h1-5H;;/q-2;2*+1 |
| InChIKey | VRIZGLPHNWWKPU-UHFFFAOYSA-N |
| XLogP | -6.65 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.06 |
| LogP ≤ 5 | -6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;dioxido(phenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;dioxido(phenyl)phosphane?
The IUPAC name of disodium;dioxido(phenyl)phosphane (CID 22598239) is disodium;dioxido(phenyl)phosphane.
What is the SMILES notation for disodium;dioxido(phenyl)phosphane?
The canonical SMILES for disodium;dioxido(phenyl)phosphane is [Na+].[Na+].[O-]P([O-])c1ccccc1.
What is the InChIKey of disodium;dioxido(phenyl)phosphane?
The InChIKey is VRIZGLPHNWWKPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5O2P.2Na/c7-9(8)6-4-2-1-3-5-6;;/h1-5H;;/q-2;2*+1.
What are the key properties of disodium;dioxido(phenyl)phosphane?
disodium;dioxido(phenyl)phosphane has a molecular weight of 186.06 g/mol, XLogP of -6.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;dioxido(phenyl)phosphane is sourced from PubChem (CID 22598239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).