C35H36F3N3O2 — CID 166518424
2-hydroxy-1-[2-[1-(3-propan-2-ylphenyl)cyclopropyl]-1,4,5,7,8,9-hexahydropyrimido[5,4-c]azepin-6-yl]-2-[3-[3-(trifluoromethyl)phenyl]phenyl]ethanone (PubChem CID 166518424) has the molecular formula C35H36F3N3O2 and a molecular weight of 587.69 g/mol. Its IUPAC name is 2-hydroxy-1-[2-[1-(3-propan-2-ylphenyl)cyclopropyl]-1,4,5,7,8,9-hexahydropyrimido[5,4-c]azepin-6-yl]-2-[3-[3-(trifluoromethyl)phenyl]phenyl]ethanone.
| Compound Name | 2-hydroxy-1-[2-[1-(3-propan-2-ylphenyl)cyclopropyl]-1,4,5,7,8,9-hexahydropyrimido[5,4-c]azepin-6-yl]-2-[3-[3-(trifluoromethyl)phenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 166518424 |
| Molecular Formula | C35H36F3N3O2 |
| Molecular Weight | 587.69 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | 2-hydroxy-1-[2-[1-(3-propan-2-ylphenyl)cyclopropyl]-1,4,5,7,8,9-hexahydropyrimido[5,4-c]azepin-6-yl]-2-[3-[3-(trifluoromethyl)phenyl]phenyl]ethanone |
| SMILES | CC(C)c1cccc(C2(C3=NCC4=C(CCCN(C(=O)C(O)c5cccc(-c6cccc(C(F)(F)F)c6)c5)C4)N3)CC2)c1 |
| InChI | InChI=1S/C35H36F3N3O2/c1-22(2)23-7-4-11-28(18-23)34(14-15-34)33-39-20-27-21-41(16-6-13-30(27)40-33)32(43)31(42)26-10-3-8-24(17-26)25-9-5-12-29(19-25)35(36,37)38/h3-5,7-12,17-19,22,31,42H,6,13-16,20-21H2,1-2H3,(H,39,40) |
| InChIKey | AEPDXCRLPPLZAL-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.69 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |