C34H37N3O3 — CID 176887392
(2R)-2-hydroxy-1-[2-(1-phenylcyclopropyl)-1,4,5,7,8,9-hexahydropyrimido[5,4-c]azepin-6-yl]-2-[3-(3-propan-2-yloxyphenyl)phenyl]ethanone (PubChem CID 176887392) has the molecular formula C34H37N3O3 and a molecular weight of 535.69 g/mol. Its IUPAC name is (2R)-2-hydroxy-1-[2-(1-phenylcyclopropyl)-1,4,5,7,8,9-hexahydropyrimido[5,4-c]azepin-6-yl]-2-[3-(3-propan-2-yloxyphenyl)phenyl]ethanone.
| Compound Name | (2R)-2-hydroxy-1-[2-(1-phenylcyclopropyl)-1,4,5,7,8,9-hexahydropyrimido[5,4-c]azepin-6-yl]-2-[3-(3-propan-2-yloxyphenyl)phenyl]ethanone |
|---|---|
| PubChem CID | 176887392 |
| Molecular Formula | C34H37N3O3 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | (2R)-2-hydroxy-1-[2-(1-phenylcyclopropyl)-1,4,5,7,8,9-hexahydropyrimido[5,4-c]azepin-6-yl]-2-[3-(3-propan-2-yloxyphenyl)phenyl]ethanone |
| SMILES | CC(C)Oc1cccc(-c2cccc([C@@H](O)C(=O)N3CCCC4=C(CN=C(C5(c6ccccc6)CC5)N4)C3)c2)c1 |
| InChI | InChI=1S/C34H37N3O3/c1-23(2)40-29-14-7-10-25(20-29)24-9-6-11-26(19-24)31(38)32(39)37-18-8-15-30-27(22-37)21-35-33(36-30)34(16-17-34)28-12-4-3-5-13-28/h3-7,9-14,19-20,23,31,38H,8,15-18,21-22H2,1-2H3,(H,35,36)/t31-/m1/s1 |
| InChIKey | PSHFVOPBDGZZHD-WJOKGBTCSA-N |
| XLogP | 5.78 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |