C20H19ClN4O4 — CID 16651940
N-(5-acetyl-2-methoxyphenyl)-1-(4-chlorophenyl)-5-(methoxymethyl)triazole-4-carboxamide (PubChem CID 16651940) has the molecular formula C20H19ClN4O4 and a molecular weight of 414.85 g/mol. Its IUPAC name is N-(5-acetyl-2-methoxyphenyl)-1-(4-chlorophenyl)-5-(methoxymethyl)triazole-4-carboxamide.
| Compound Name | N-(5-acetyl-2-methoxyphenyl)-1-(4-chlorophenyl)-5-(methoxymethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 16651940 |
| Molecular Formula | C20H19ClN4O4 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-(5-acetyl-2-methoxyphenyl)-1-(4-chlorophenyl)-5-(methoxymethyl)triazole-4-carboxamide |
| SMILES | COCc1c(C(=O)Nc2cc(C(C)=O)ccc2OC)nnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClN4O4/c1-12(26)13-4-9-18(29-3)16(10-13)22-20(27)19-17(11-28-2)25(24-23-19)15-7-5-14(21)6-8-15/h4-10H,11H2,1-3H3,(H,22,27) |
| InChIKey | CKZXVTRUIVHXIN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |