C16H24F2OSi — CID 166519402
(2,2-Difluoro-1-phenylbut-3-enoxy)-triethylsilane (PubChem CID 166519402) has the molecular formula C16H24F2OSi and a molecular weight of 298.44 g/mol. Its IUPAC name is (2,2-difluoro-1-phenylbut-3-enoxy)-triethylsilane.
| Compound Name | (2,2-Difluoro-1-phenylbut-3-enoxy)-triethylsilane |
|---|---|
| PubChem CID | 166519402 |
| Molecular Formula | C16H24F2OSi |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (2,2-difluoro-1-phenylbut-3-enoxy)-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC(C1=CC=CC=C1)C(C=C)(F)F |
| InChI | InChI=1S/C16H24F2OSi/c1-5-16(17,18)15(14-12-10-9-11-13-14)19-20(6-2,7-3)8-4/h5,9-13,15H,1,6-8H2,2-4H3 |
| InChIKey | NCPVAGRHTRAJNX-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | 289 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|