C8H11Cl2F6O3P — CID 166520984
dichloro-[3-(2,2,2-trifluoroethoxy)-2-(2,2,2-trifluoroethoxymethyl)propoxy]phosphane (PubChem CID 166520984) has the molecular formula C8H11Cl2F6O3P and a molecular weight of 371.04 g/mol. Its IUPAC name is dichloro-[3-(2,2,2-trifluoroethoxy)-2-(2,2,2-trifluoroethoxymethyl)propoxy]phosphane.
| Compound Name | dichloro-[3-(2,2,2-trifluoroethoxy)-2-(2,2,2-trifluoroethoxymethyl)propoxy]phosphane |
|---|---|
| PubChem CID | 166520984 |
| Molecular Formula | C8H11Cl2F6O3P |
| Molecular Weight | 371.04 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | dichloro-[3-(2,2,2-trifluoroethoxy)-2-(2,2,2-trifluoroethoxymethyl)propoxy]phosphane |
| SMILES | FC(F)(F)COCC(COCC(F)(F)F)COP(Cl)Cl |
| InChI | InChI=1S/C8H11Cl2F6O3P/c9-20(10)19-3-6(1-17-4-7(11,12)13)2-18-5-8(14,15)16/h6H,1-5H2 |
| InChIKey | UTNBWAMETTYOMI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.04 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|