C17H15FN2O3S — CID 166521368
N-[4-(aminomethyl)-2-(furan-2-yl)phenyl]-4-fluorobenzenesulfonamide (PubChem CID 166521368) has the molecular formula C17H15FN2O3S and a molecular weight of 346.38 g/mol. Its IUPAC name is N-[4-(aminomethyl)-2-(furan-2-yl)phenyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[4-(aminomethyl)-2-(furan-2-yl)phenyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 166521368 |
| Molecular Formula | C17H15FN2O3S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | N-[4-(aminomethyl)-2-(furan-2-yl)phenyl]-4-fluorobenzenesulfonamide |
| SMILES | NCc1ccc(NS(=O)(=O)c2ccc(F)cc2)c(-c2ccco2)c1 |
| InChI | InChI=1S/C17H15FN2O3S/c18-13-4-6-14(7-5-13)24(21,22)20-16-8-3-12(11-19)10-15(16)17-2-1-9-23-17/h1-10,20H,11,19H2 |
| InChIKey | IGNUYIKMOURZAT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |