About N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-fluorobenzenesulfonamide
N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-fluorobenzenesulfonamide (PubChem CID 25331204) has the molecular formula C17H11FN2O4S2
and a molecular weight of 390.42 g/mol. Its IUPAC name is N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-fluorobenzenesulfonamide |
| PubChem CID | 25331204 |
| Molecular Formula | C17H11FN2O4S2 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc(-c2ccco2)c(-c2ccco2)s1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H11FN2O4S2/c18-11-5-7-12(8-6-11)26(21,22)20-17-19-15(13-3-1-9-23-13)16(25-17)14-4-2-10-24-14/h1-10H,(H,19,20) |
| InChIKey | BFGOYPDCPYMMKX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|
Analyze N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-fluorobenzenesulfonamide?
The IUPAC name of N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-fluorobenzenesulfonamide (CID 25331204) is N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-fluorobenzenesulfonamide.
What is the SMILES notation for N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-fluorobenzenesulfonamide?
The canonical SMILES for N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-fluorobenzenesulfonamide is O=S(=O)(Nc1nc(-c2ccco2)c(-c2ccco2)s1)c1ccc(F)cc1.
What is the InChIKey of N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-fluorobenzenesulfonamide?
The InChIKey is BFGOYPDCPYMMKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11FN2O4S2/c18-11-5-7-12(8-6-11)26(21,22)20-17-19-15(13-3-1-9-23-13)16(25-17)14-4-2-10-24-14/h1-10H,(H,19,20).
What are the key properties of N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-fluorobenzenesulfonamide?
N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-fluorobenzenesulfonamide has a molecular weight of 390.42 g/mol, XLogP of 4.60, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-fluorobenzenesulfonamide is sourced from PubChem (CID 25331204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).