C15H13NO4S2 — CID 166521430
N-[2-(furan-2-yl)-4-(hydroxymethyl)phenyl]thiophene-3-sulfonamide (PubChem CID 166521430) has the molecular formula C15H13NO4S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-4-(hydroxymethyl)phenyl]thiophene-3-sulfonamide.
| Compound Name | N-[2-(furan-2-yl)-4-(hydroxymethyl)phenyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 166521430 |
| Molecular Formula | C15H13NO4S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | N-[2-(furan-2-yl)-4-(hydroxymethyl)phenyl]thiophene-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(CO)cc1-c1ccco1)c1ccsc1 |
| InChI | InChI=1S/C15H13NO4S2/c17-9-11-3-4-14(13(8-11)15-2-1-6-20-15)16-22(18,19)12-5-7-21-10-12/h1-8,10,16-17H,9H2 |
| InChIKey | MYCBYFMDNDUZAX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |