C12H12BrClN2O2 — CID 166521800
N-(5-bromo-3-chloro-4-cyano-2-methylphenyl)-2-hydroxy-2-methylpropanamide (PubChem CID 166521800) has the molecular formula C12H12BrClN2O2 and a molecular weight of 331.60 g/mol. Its IUPAC name is N-(5-bromo-3-chloro-4-cyano-2-methylphenyl)-2-hydroxy-2-methylpropanamide.
| Compound Name | N-(5-bromo-3-chloro-4-cyano-2-methylphenyl)-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 166521800 |
| Molecular Formula | C12H12BrClN2O2 |
| Molecular Weight | 331.60 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | N-(5-bromo-3-chloro-4-cyano-2-methylphenyl)-2-hydroxy-2-methylpropanamide |
| SMILES | Cc1c(NC(=O)C(C)(C)O)cc(Br)c(C#N)c1Cl |
| InChI | InChI=1S/C12H12BrClN2O2/c1-6-9(16-11(17)12(2,3)18)4-8(13)7(5-15)10(6)14/h4,18H,1-3H3,(H,16,17) |
| InChIKey | IDECPIPYNKVSDJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.60 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |