C27H28N6O — CID 166523333
6-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-3-[(1S,2S)-2-phenylcyclopropyl]-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 166523333) has the molecular formula C27H28N6O and a molecular weight of 452.56 g/mol. Its IUPAC name is 6-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-3-[(1S,2S)-2-phenylcyclopropyl]-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 6-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-3-[(1S,2S)-2-phenylcyclopropyl]-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 166523333 |
| Molecular Formula | C27H28N6O |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 6-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-3-[(1S,2S)-2-phenylcyclopropyl]-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | N[C@@H]1c2ccccc2CC12CCN(c1nc3n[nH]c([C@H]4C[C@@H]4c4ccccc4)c3c(=O)[nH]1)CC2 |
| InChI | InChI=1S/C27H28N6O/c28-23-18-9-5-4-8-17(18)15-27(23)10-12-33(13-11-27)26-29-24-21(25(34)30-26)22(31-32-24)20-14-19(20)16-6-2-1-3-7-16/h1-9,19-20,23H,10-15,28H2,(H2,29,30,31,32,34)/t19-,20+,23-/m1/s1 |
| InChIKey | QMQSNIOKSDSGKA-ZRCGQRJVSA-N |
| XLogP | 3.76 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |