C29H31FN6O — CID 166885201
6-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-3-(4-fluoro-3,3-dimethyl-1,2-dihydroinden-1-yl)-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 166885201) has the molecular formula C29H31FN6O and a molecular weight of 498.61 g/mol. Its IUPAC name is 6-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-3-(4-fluoro-3,3-dimethyl-1,2-dihydroinden-1-yl)-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 6-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-3-(4-fluoro-3,3-dimethyl-1,2-dihydroinden-1-yl)-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 166885201 |
| Molecular Formula | C29H31FN6O |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 6-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-3-(4-fluoro-3,3-dimethyl-1,2-dihydroinden-1-yl)-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | CC1(C)CC(c2[nH]nc3nc(N4CCC5(CC4)Cc4ccccc4[C@H]5N)[nH]c(=O)c23)c2cccc(F)c21 |
| InChI | InChI=1S/C29H31FN6O/c1-28(2)15-19(18-8-5-9-20(30)22(18)28)23-21-25(35-34-23)32-27(33-26(21)37)36-12-10-29(11-13-36)14-16-6-3-4-7-17(16)24(29)31/h3-9,19,24H,10-15,31H2,1-2H3,(H2,32,33,34,35,37)/t19?,24-/m1/s1 |
| InChIKey | RDDUMHCODIMQIG-JKSFWZLDSA-N |
| XLogP | 4.44 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |