C29H35F2N5O3 — CID 166524671
propan-2-yl 2-[6-[(1R)-1-aminoethyl]-1-(2,2-difluorohept-6-enyl)pyrrolo[2,3-b]pyridin-2-yl]-7-methoxy-1-methylbenzimidazole-5-carboxylate (PubChem CID 166524671) has the molecular formula C29H35F2N5O3 and a molecular weight of 539.63 g/mol. Its IUPAC name is propan-2-yl 2-[6-[(1R)-1-aminoethyl]-1-(2,2-difluorohept-6-enyl)pyrrolo[2,3-b]pyridin-2-yl]-7-methoxy-1-methylbenzimidazole-5-carboxylate.
| Compound Name | propan-2-yl 2-[6-[(1R)-1-aminoethyl]-1-(2,2-difluorohept-6-enyl)pyrrolo[2,3-b]pyridin-2-yl]-7-methoxy-1-methylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 166524671 |
| Molecular Formula | C29H35F2N5O3 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | propan-2-yl 2-[6-[(1R)-1-aminoethyl]-1-(2,2-difluorohept-6-enyl)pyrrolo[2,3-b]pyridin-2-yl]-7-methoxy-1-methylbenzimidazole-5-carboxylate |
| SMILES | C=CCCCC(F)(F)Cn1c(-c2nc3cc(C(=O)OC(C)C)cc(OC)c3n2C)cc2ccc([C@@H](C)N)nc21 |
| InChI | InChI=1S/C29H35F2N5O3/c1-7-8-9-12-29(30,31)16-36-23(14-19-10-11-21(18(4)32)33-26(19)36)27-34-22-13-20(28(37)39-17(2)3)15-24(38-6)25(22)35(27)5/h7,10-11,13-15,17-18H,1,8-9,12,16,32H2,2-6H3/t18-/m1/s1 |
| InChIKey | KWROXYDASUWIGE-GOSISDBHSA-N |
| XLogP | 6.18 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|