C24H25FN4O2 — CID 166815247
methyl 2-(6-ethyl-1-pent-4-enylpyrrolo[2,3-b]pyridin-2-yl)-7-fluoro-1-methylbenzimidazole-5-carboxylate (PubChem CID 166815247) has the molecular formula C24H25FN4O2 and a molecular weight of 420.49 g/mol. Its IUPAC name is methyl 2-(6-ethyl-1-pent-4-enylpyrrolo[2,3-b]pyridin-2-yl)-7-fluoro-1-methylbenzimidazole-5-carboxylate.
| Compound Name | methyl 2-(6-ethyl-1-pent-4-enylpyrrolo[2,3-b]pyridin-2-yl)-7-fluoro-1-methylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 166815247 |
| Molecular Formula | C24H25FN4O2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | methyl 2-(6-ethyl-1-pent-4-enylpyrrolo[2,3-b]pyridin-2-yl)-7-fluoro-1-methylbenzimidazole-5-carboxylate |
| SMILES | C=CCCCn1c(-c2nc3cc(C(=O)OC)cc(F)c3n2C)cc2ccc(CC)nc21 |
| InChI | InChI=1S/C24H25FN4O2/c1-5-7-8-11-29-20(14-15-9-10-17(6-2)26-22(15)29)23-27-19-13-16(24(30)31-4)12-18(25)21(19)28(23)3/h5,9-10,12-14H,1,6-8,11H2,2-4H3 |
| InChIKey | XGAURPCPFRRYSC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|