C31H39N5O3Si — CID 174032510
CID 174032510 (PubChem CID 174032510) has the molecular formula C31H39N5O3Si and a molecular weight of 557.77 g/mol.
| Compound Name | CID 174032510 |
|---|---|
| PubChem CID | 174032510 |
| Molecular Formula | C31H39N5O3Si |
| Molecular Weight | 557.77 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | — |
| SMILES | C=CCCCn1c(-c2nc3cc(C(=O)OC(C)C)cc(OC)c3n2C)cc2ccc(C(C)=N[Si]C(C)(C)C)nc21 |
| InChI | InChI=1S/C31H39N5O3Si/c1-10-11-12-15-36-25(17-21-13-14-23(32-28(21)36)20(4)34-40-31(5,6)7)29-33-24-16-22(30(37)39-19(2)3)18-26(38-9)27(24)35(29)8/h10,13-14,16-19H,1,11-12,15H2,2-9H3 |
| InChIKey | VWFQRFVJVOKMNH-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.77 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|