C14H23NO4 — CID 166524927
tert-butyl 4-(5-hydroxypentyl)-5-methyl-1,2-oxazole-3-carboxylate (PubChem CID 166524927) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is tert-butyl 4-(5-hydroxypentyl)-5-methyl-1,2-oxazole-3-carboxylate.
| Compound Name | tert-butyl 4-(5-hydroxypentyl)-5-methyl-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 166524927 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | tert-butyl 4-(5-hydroxypentyl)-5-methyl-1,2-oxazole-3-carboxylate |
| SMILES | Cc1onc(C(=O)OC(C)(C)C)c1CCCCCO |
| InChI | InChI=1S/C14H23NO4/c1-10-11(8-6-5-7-9-16)12(15-19-10)13(17)18-14(2,3)4/h16H,5-9H2,1-4H3 |
| InChIKey | YCGVSRLCALBFQU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|