C19H28BrNO2 — CID 166525169
(4R)-4-benzyl-3-[(2R)-8-bromo-2-methyloctyl]-1,3-oxazolidin-2-one (PubChem CID 166525169) has the molecular formula C19H28BrNO2 and a molecular weight of 382.34 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R)-8-bromo-2-methyloctyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R)-8-bromo-2-methyloctyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 166525169 |
| Molecular Formula | C19H28BrNO2 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R)-8-bromo-2-methyloctyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](CCCCCCBr)CN1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C19H28BrNO2/c1-16(9-5-2-3-8-12-20)14-21-18(15-23-19(21)22)13-17-10-6-4-7-11-17/h4,6-7,10-11,16,18H,2-3,5,8-9,12-15H2,1H3/t16-,18-/m1/s1 |
| InChIKey | JUJAGQPNDWMSMN-SJLPKXTDSA-N |
| XLogP | 5.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|