C28H18CuF12N2O4 — CID 166528346
copper;bis(4-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]-2,6-bis(trifluoromethyl)benzonitrile) (PubChem CID 166528346) has the molecular formula C28H18CuF12N2O4 and a molecular weight of 737.98 g/mol. Its IUPAC name is copper;bis(4-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]-2,6-bis(trifluoromethyl)benzonitrile).
| Compound Name | copper;bis(4-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]-2,6-bis(trifluoromethyl)benzonitrile) |
|---|---|
| PubChem CID | 166528346 |
| Molecular Formula | C28H18CuF12N2O4 |
| Molecular Weight | 737.98 g/mol |
| Exact Mass | 737.04 |
| IUPAC Name | copper;bis(4-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]-2,6-bis(trifluoromethyl)benzonitrile) |
| SMILES | CC(=O)/C(=C(/C)O)c1cc(C(F)(F)F)c(C#N)c(C(F)(F)F)c1.CC(=O)/C(=C(/C)O)c1cc(C(F)(F)F)c(C#N)c(C(F)(F)F)c1.[Cu] |
| InChI | InChI=1S/2C14H9F6NO2.Cu/c2*1-6(22)12(7(2)23)8-3-10(13(15,16)17)9(5-21)11(4-8)14(18,19)20;/h2*3-4,22H,1-2H3;/b2*12-6+; |
| InChIKey | VEBFGNKVWUWKQQ-FWWOJAOHSA-N |
| XLogP | 8.95 |
| TPSA | 122.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.98 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|