C11H13F3N2O3 — CID 166528462
1-(oxan-4-ylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid (PubChem CID 166528462) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is 1-(oxan-4-ylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid.
| Compound Name | 1-(oxan-4-ylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 166528462 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-(oxan-4-ylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(C(F)(F)F)nn1CC1CCOCC1 |
| InChI | InChI=1S/C11H13F3N2O3/c12-11(13,14)9-5-8(10(17)18)16(15-9)6-7-1-3-19-4-2-7/h5,7H,1-4,6H2,(H,17,18) |
| InChIKey | PTNJLZMAPWMBPV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |