C13H17F3N4O2 — CID 171992604
2-[4-[[6-oxo-3-(trifluoromethyl)pyridazin-1-yl]methyl]piperidin-1-yl]acetamide (PubChem CID 171992604) has the molecular formula C13H17F3N4O2 and a molecular weight of 318.30 g/mol. Its IUPAC name is 2-[4-[[6-oxo-3-(trifluoromethyl)pyridazin-1-yl]methyl]piperidin-1-yl]acetamide.
| Compound Name | 2-[4-[[6-oxo-3-(trifluoromethyl)pyridazin-1-yl]methyl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 171992604 |
| Molecular Formula | C13H17F3N4O2 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 2-[4-[[6-oxo-3-(trifluoromethyl)pyridazin-1-yl]methyl]piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCC(Cn2nc(C(F)(F)F)ccc2=O)CC1 |
| InChI | InChI=1S/C13H17F3N4O2/c14-13(15,16)10-1-2-12(22)20(18-10)7-9-3-5-19(6-4-9)8-11(17)21/h1-2,9H,3-8H2,(H2,17,21) |
| InChIKey | ADBPSYMEYDYKHC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |